C18H12ClFN2O2S2 — CID 6532036
N-(3-chloro-4-fluorophenyl)-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide (PubChem CID 6532036) has the molecular formula C18H12ClFN2O2S2 and a molecular weight of 406.89 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 6532036 |
| Molecular Formula | C18H12ClFN2O2S2 |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide |
| SMILES | CN1C(=O)/C(=C/c2ccc(C(=O)Nc3ccc(F)c(Cl)c3)cc2)SC1=S |
| InChI | InChI=1S/C18H12ClFN2O2S2/c1-22-17(24)15(26-18(22)25)8-10-2-4-11(5-3-10)16(23)21-12-6-7-14(20)13(19)9-12/h2-9H,1H3,(H,21,23)/b15-8- |
| InChIKey | RUNIREODMSZWIL-NVNXTCNLSA-N |
| XLogP | 4.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|