C24H26Cl2N2O2S — CID 3928165
N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-4-heptoxybenzamide (PubChem CID 3928165) has the molecular formula C24H26Cl2N2O2S and a molecular weight of 477.46 g/mol. Its IUPAC name is N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-4-heptoxybenzamide.
| Compound Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-4-heptoxybenzamide |
|---|---|
| PubChem CID | 3928165 |
| Molecular Formula | C24H26Cl2N2O2S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2ncc(Cc3cc(Cl)ccc3Cl)s2)cc1 |
| InChI | InChI=1S/C24H26Cl2N2O2S/c1-2-3-4-5-6-13-30-20-10-7-17(8-11-20)23(29)28-24-27-16-21(31-24)15-18-14-19(25)9-12-22(18)26/h7-12,14,16H,2-6,13,15H2,1H3,(H,27,28,29) |
| InChIKey | IDRYRKZJLQIZFS-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|