C23H22ClF3N2O2S — CID 3608845
N-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-4-pentoxybenzamide (PubChem CID 3608845) has the molecular formula C23H22ClF3N2O2S and a molecular weight of 482.96 g/mol. Its IUPAC name is N-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-4-pentoxybenzamide.
| Compound Name | N-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 3608845 |
| Molecular Formula | C23H22ClF3N2O2S |
| Molecular Weight | 482.96 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | N-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2ncc(Cc3cc(Cl)ccc3C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C23H22ClF3N2O2S/c1-2-3-4-11-31-18-8-5-15(6-9-18)21(30)29-22-28-14-19(32-22)13-16-12-17(24)7-10-20(16)23(25,26)27/h5-10,12,14H,2-4,11,13H2,1H3,(H,28,29,30) |
| InChIKey | QXJKNETXUGMYTR-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.96 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|