C22H20ClF3N2O2S — CID 3276355
2-butoxy-N-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 3276355) has the molecular formula C22H20ClF3N2O2S and a molecular weight of 468.93 g/mol. Its IUPAC name is 2-butoxy-N-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-butoxy-N-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3276355 |
| Molecular Formula | C22H20ClF3N2O2S |
| Molecular Weight | 468.93 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2-butoxy-N-[5-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)Nc1ncc(Cc2cc(Cl)ccc2C(F)(F)F)s1 |
| InChI | InChI=1S/C22H20ClF3N2O2S/c1-2-3-10-30-19-7-5-4-6-17(19)20(29)28-21-27-13-16(31-21)12-14-11-15(23)8-9-18(14)22(24,25)26/h4-9,11,13H,2-3,10,12H2,1H3,(H,27,28,29) |
| InChIKey | UNKAZYLLWJSGSD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.93 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|