C23H21ClN4O5S2 — CID 4759667
N'-[6-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-3-nitrobenzohydrazide (PubChem CID 4759667) has the molecular formula C23H21ClN4O5S2 and a molecular weight of 533.03 g/mol. Its IUPAC name is N'-[6-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[6-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 4759667 |
| Molecular Formula | C23H21ClN4O5S2 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | N'-[6-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoyl]-3-nitrobenzohydrazide |
| SMILES | O=C(CCCCCN1C(=O)C(=Cc2ccc(Cl)cc2)SC1=S)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21ClN4O5S2/c24-17-10-8-15(9-11-17)13-19-22(31)27(23(34)35-19)12-3-1-2-7-20(29)25-26-21(30)16-5-4-6-18(14-16)28(32)33/h4-6,8-11,13-14H,1-3,7,12H2,(H,25,29)(H,26,30) |
| InChIKey | HNGYTRRTGWOQGO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|