C17H19Cl3N2O3S2 — CID 2851374
2-(dimethylamino)ethyl 3-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate;hydrochloride (PubChem CID 2851374) has the molecular formula C17H19Cl3N2O3S2 and a molecular weight of 469.84 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 3-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate;hydrochloride.
| Compound Name | 2-(dimethylamino)ethyl 3-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 2851374 |
| Molecular Formula | C17H19Cl3N2O3S2 |
| Molecular Weight | 469.84 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | 2-(dimethylamino)ethyl 3-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate;hydrochloride |
| SMILES | CN(C)CCOC(=O)CCN1C(=O)C(=Cc2ccc(Cl)cc2Cl)SC1=S.Cl |
| InChI | InChI=1S/C17H18Cl2N2O3S2.ClH/c1-20(2)7-8-24-15(22)5-6-21-16(23)14(26-17(21)25)9-11-3-4-12(18)10-13(11)19;/h3-4,9-10H,5-8H2,1-2H3;1H |
| InChIKey | WMHLEBHMZFBCNP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.84 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|