C18H22ClN2O3S2+ — CID 5109883
2-[4-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyloxy]ethyl-dimethylazanium (PubChem CID 5109883) has the molecular formula C18H22ClN2O3S2+ and a molecular weight of 413.97 g/mol. Its IUPAC name is 2-[4-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyloxy]ethyl-dimethylazanium.
| Compound Name | 2-[4-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyloxy]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 5109883 |
| Molecular Formula | C18H22ClN2O3S2+ |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-[4-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoyloxy]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCOC(=O)CCCN1C(=O)C(=Cc2ccccc2Cl)SC1=S |
| InChI | InChI=1S/C18H21ClN2O3S2/c1-20(2)10-11-24-16(22)8-5-9-21-17(23)15(26-18(21)25)12-13-6-3-4-7-14(13)19/h3-4,6-7,12H,5,8-11H2,1-2H3/p+1 |
| InChIKey | JWELNXGAOXAPMY-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|