C23H20BrCl2NO4S2 — CID 19199443
ethyl 4-[(5E)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199443) has the molecular formula C23H20BrCl2NO4S2 and a molecular weight of 589.36 g/mol. Its IUPAC name is ethyl 4-[(5E)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | ethyl 4-[(5E)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199443 |
| Molecular Formula | C23H20BrCl2NO4S2 |
| Molecular Weight | 589.36 g/mol |
| Exact Mass | 586.94 |
| IUPAC Name | ethyl 4-[(5E)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCN1C(=O)/C(=C\c2cc(Br)ccc2OCc2ccc(Cl)cc2Cl)SC1=S |
| InChI | InChI=1S/C23H20BrCl2NO4S2/c1-2-30-21(28)4-3-9-27-22(29)20(33-23(27)32)11-15-10-16(24)6-8-19(15)31-13-14-5-7-17(25)12-18(14)26/h5-8,10-12H,2-4,9,13H2,1H3/b20-11+ |
| InChIKey | WFNIEJZCSPADKU-RGVLZGJSSA-N |
| XLogP | 6.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.36 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|