C13H10ClNO4S2 — CID 10497582
2-[4-chloro-2-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid (PubChem CID 10497582) has the molecular formula C13H10ClNO4S2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-[4-chloro-2-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10497582 |
| Molecular Formula | C13H10ClNO4S2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | 2-[4-chloro-2-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid |
| SMILES | CN1C(=O)/C(=C\c2cc(Cl)ccc2OCC(=O)O)SC1=S |
| InChI | InChI=1S/C13H10ClNO4S2/c1-15-12(18)10(21-13(15)20)5-7-4-8(14)2-3-9(7)19-6-11(16)17/h2-5H,6H2,1H3,(H,16,17)/b10-5+ |
| InChIKey | IRTNDOALRUUAPB-BJMVGYQFSA-N |
| XLogP | 2.63 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|