C39H34N4O9S2 — CID 71834549
ethyl 4-[[2-[2-[[3-[[2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetyl]amino]benzoate (PubChem CID 71834549) has the molecular formula C39H34N4O9S2 and a molecular weight of 766.85 g/mol. Its IUPAC name is ethyl 4-[[2-[2-[[3-[[2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-[[3-[[2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 71834549 |
| Molecular Formula | C39H34N4O9S2 |
| Molecular Weight | 766.85 g/mol |
| Exact Mass | 766.18 |
| IUPAC Name | ethyl 4-[[2-[2-[[3-[[2-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccccc2C=NN2C(=O)C(=Cc3ccccc3OCC(=O)Nc3ccc(C(=O)OCC)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C39H34N4O9S2/c1-3-49-37(47)25-13-17-29(18-14-25)41-34(44)23-51-31-11-7-5-9-27(31)21-33-36(46)43(39(53)54-33)40-22-28-10-6-8-12-32(28)52-24-35(45)42-30-19-15-26(16-20-30)38(48)50-4-2/h5-22H,3-4,23-24H2,1-2H3,(H,41,44)(H,42,45) |
| InChIKey | WTBOHDPHKHNUQT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 161.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.85 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|