C19H13BrN2O5S2 — CID 135821713
2-[2-[[3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 135821713) has the molecular formula C19H13BrN2O5S2 and a molecular weight of 493.36 g/mol. Its IUPAC name is 2-[2-[[3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 135821713 |
| Molecular Formula | C19H13BrN2O5S2 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 491.94 |
| IUPAC Name | 2-[2-[[3-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1C=C1SC(=S)N(/N=C/c2cc(Br)ccc2O)C1=O |
| InChI | InChI=1S/C19H13BrN2O5S2/c20-13-5-6-14(23)12(7-13)9-21-22-18(26)16(29-19(22)28)8-11-3-1-2-4-15(11)27-10-17(24)25/h1-9,23H,10H2,(H,24,25)/b16-8?,21-9+ |
| InChIKey | MHFOFCHRWLBUNF-PKYSLXPTSA-N |
| XLogP | 3.85 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|