C20H15BrN2O5S2 — CID 3296438
2-[2-[[5-[(3-bromo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]phenoxy]acetic acid (PubChem CID 3296438) has the molecular formula C20H15BrN2O5S2 and a molecular weight of 507.39 g/mol. Its IUPAC name is 2-[2-[[5-[(3-bromo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[5-[(3-bromo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 3296438 |
| Molecular Formula | C20H15BrN2O5S2 |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 505.96 |
| IUPAC Name | 2-[2-[[5-[(3-bromo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]phenoxy]acetic acid |
| SMILES | COc1ccc(C=C2SC(=S)N(N=Cc3ccccc3OCC(=O)O)C2=O)cc1Br |
| InChI | InChI=1S/C20H15BrN2O5S2/c1-27-16-7-6-12(8-14(16)21)9-17-19(26)23(20(29)30-17)22-10-13-4-2-3-5-15(13)28-11-18(24)25/h2-10H,11H2,1H3,(H,24,25) |
| InChIKey | QTJXPCMIJUYERB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|