C22H21N3O4S2 — CID 4710765
2-[2-[(3-morpholin-4-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-phenylacetamide (PubChem CID 4710765) has the molecular formula C22H21N3O4S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[2-[(3-morpholin-4-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[(3-morpholin-4-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 4710765 |
| Molecular Formula | C22H21N3O4S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 2-[2-[(3-morpholin-4-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccccc1C=C1SC(=S)N(N2CCOCC2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H21N3O4S2/c26-20(23-17-7-2-1-3-8-17)15-29-18-9-5-4-6-16(18)14-19-21(27)25(22(30)31-19)24-10-12-28-13-11-24/h1-9,14H,10-13,15H2,(H,23,26) |
| InChIKey | KQHFKJBWNDBLQB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|