C23H23N5O5S2 — CID 4710679
2-[2-[[3-(4-methylpiperazin-1-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-nitrophenoxy]-N-phenylacetamide (PubChem CID 4710679) has the molecular formula C23H23N5O5S2 and a molecular weight of 513.60 g/mol. Its IUPAC name is 2-[2-[[3-(4-methylpiperazin-1-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-nitrophenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[[3-(4-methylpiperazin-1-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-nitrophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 4710679 |
| Molecular Formula | C23H23N5O5S2 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 2-[2-[[3-(4-methylpiperazin-1-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-nitrophenoxy]-N-phenylacetamide |
| SMILES | CN1CCN(N2C(=O)C(=Cc3cc([N+](=O)[O-])ccc3OCC(=O)Nc3ccccc3)SC2=S)CC1 |
| InChI | InChI=1S/C23H23N5O5S2/c1-25-9-11-26(12-10-25)27-22(30)20(35-23(27)34)14-16-13-18(28(31)32)7-8-19(16)33-15-21(29)24-17-5-3-2-4-6-17/h2-8,13-14H,9-12,15H2,1H3,(H,24,29) |
| InChIKey | NBUJRTAFZCYCJA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|