C19H16N4O5 — CID 18807343
2-[2-[(Z)-(3-methyl-5-oxo-1H-pyrazol-4-ylidene)methyl]-4-nitrophenoxy]-N-phenylacetamide (PubChem CID 18807343) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is 2-[2-[(Z)-(3-methyl-5-oxo-1H-pyrazol-4-ylidene)methyl]-4-nitrophenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[(Z)-(3-methyl-5-oxo-1H-pyrazol-4-ylidene)methyl]-4-nitrophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 18807343 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-[2-[(Z)-(3-methyl-5-oxo-1H-pyrazol-4-ylidene)methyl]-4-nitrophenoxy]-N-phenylacetamide |
| SMILES | CC1=NNC(=O)/C1=C\c1cc([N+](=O)[O-])ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H16N4O5/c1-12-16(19(25)22-21-12)10-13-9-15(23(26)27)7-8-17(13)28-11-18(24)20-14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H,20,24)(H,22,25)/b16-10- |
| InChIKey | BNKWXDQICONHBY-YBEGLDIGSA-N |
| XLogP | 2.50 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|