C28H24N4O3 — CID 71833941
2-[2-[[1-(4-cyanophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 71833941) has the molecular formula C28H24N4O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-[2-[[1-(4-cyanophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-[[1-(4-cyanophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 71833941 |
| Molecular Formula | C28H24N4O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-[2-[[1-(4-cyanophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | CC1=NN(c2ccc(C#N)cc2)C(=O)C1=Cc1ccccc1OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C28H24N4O3/c1-18-8-11-23(14-19(18)2)30-27(33)17-35-26-7-5-4-6-22(26)15-25-20(3)31-32(28(25)34)24-12-9-21(16-29)10-13-24/h4-15H,17H2,1-3H3,(H,30,33) |
| InChIKey | AHOMKECMWCZDAS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|