C20H13ClN3O5- — CID 7256401
2-chloro-5-[(4Z)-3-methyl-4-[(E)-3-(3-nitrophenyl)prop-2-enylidene]-5-oxopyrazol-1-yl]benzoate (PubChem CID 7256401) has the molecular formula C20H13ClN3O5- and a molecular weight of 410.79 g/mol. Its IUPAC name is 2-chloro-5-[(4Z)-3-methyl-4-[(E)-3-(3-nitrophenyl)prop-2-enylidene]-5-oxopyrazol-1-yl]benzoate.
| Compound Name | 2-chloro-5-[(4Z)-3-methyl-4-[(E)-3-(3-nitrophenyl)prop-2-enylidene]-5-oxopyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 7256401 |
| Molecular Formula | C20H13ClN3O5- |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-chloro-5-[(4Z)-3-methyl-4-[(E)-3-(3-nitrophenyl)prop-2-enylidene]-5-oxopyrazol-1-yl]benzoate |
| SMILES | CC1=NN(c2ccc(Cl)c(C(=O)[O-])c2)C(=O)/C1=C\C=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14ClN3O5/c1-12-16(7-3-5-13-4-2-6-15(10-13)24(28)29)19(25)23(22-12)14-8-9-18(21)17(11-14)20(26)27/h2-11H,1H3,(H,26,27)/p-1/b5-3+,16-7- |
| InChIKey | WSIQANBKCHOMPU-JLJGJNDSSA-M |
| XLogP | 2.97 |
| TPSA | 115.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|