C25H26ClIN2O5 — CID 50886987
propan-2-yl 2-chloro-5-[(4Z)-4-[(3,4-diethoxy-5-iodophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate (PubChem CID 50886987) has the molecular formula C25H26ClIN2O5 and a molecular weight of 596.85 g/mol. Its IUPAC name is propan-2-yl 2-chloro-5-[(4Z)-4-[(3,4-diethoxy-5-iodophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate.
| Compound Name | propan-2-yl 2-chloro-5-[(4Z)-4-[(3,4-diethoxy-5-iodophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 50886987 |
| Molecular Formula | C25H26ClIN2O5 |
| Molecular Weight | 596.85 g/mol |
| Exact Mass | 596.06 |
| IUPAC Name | propan-2-yl 2-chloro-5-[(4Z)-4-[(3,4-diethoxy-5-iodophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate |
| SMILES | CCOc1cc(/C=C2\C(=O)N(c3ccc(Cl)c(C(=O)OC(C)C)c3)N=C2C)cc(I)c1OCC |
| InChI | InChI=1S/C25H26ClIN2O5/c1-6-32-22-12-16(11-21(27)23(22)33-7-2)10-18-15(5)28-29(24(18)30)17-8-9-20(26)19(13-17)25(31)34-14(3)4/h8-14H,6-7H2,1-5H3/b18-10- |
| InChIKey | HXSZPJGBUCTGDU-ZDLGFXPLSA-N |
| XLogP | 6.11 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.85 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|