C19H16Br2N2O3 — CID 1221892
4-[(2,3-dibromo-4,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 1221892) has the molecular formula C19H16Br2N2O3 and a molecular weight of 480.16 g/mol. Its IUPAC name is 4-[(2,3-dibromo-4,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(2,3-dibromo-4,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 1221892 |
| Molecular Formula | C19H16Br2N2O3 |
| Molecular Weight | 480.16 g/mol |
| Exact Mass | 477.95 |
| IUPAC Name | 4-[(2,3-dibromo-4,5-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | COc1cc(C=C2C(=O)N(c3ccccc3)N=C2C)c(Br)c(Br)c1OC |
| InChI | InChI=1S/C19H16Br2N2O3/c1-11-14(19(24)23(22-11)13-7-5-4-6-8-13)9-12-10-15(25-2)18(26-3)17(21)16(12)20/h4-10H,1-3H3 |
| InChIKey | LADSBEZFWSUKCX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.16 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|