C20H17BrN2O5 — CID 5337120
4-[(4E)-4-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 5337120) has the molecular formula C20H17BrN2O5 and a molecular weight of 445.27 g/mol. Its IUPAC name is 4-[(4E)-4-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 4-[(4E)-4-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 5337120 |
| Molecular Formula | C20H17BrN2O5 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 4-[(4E)-4-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | COc1cc(Br)c(/C=C2/C(=O)N(c3ccc(C(=O)O)cc3)N=C2C)cc1OC |
| InChI | InChI=1S/C20H17BrN2O5/c1-11-15(8-13-9-17(27-2)18(28-3)10-16(13)21)19(24)23(22-11)14-6-4-12(5-7-14)20(25)26/h4-10H,1-3H3,(H,25,26)/b15-8+ |
| InChIKey | ACJIQPSAJKVWPB-OVCLIPMQSA-N |
| XLogP | 3.97 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|