C24H22Br2N2O7 — CID 22307043
3-[(4Z)-4-[[2,3-dibromo-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 22307043) has the molecular formula C24H22Br2N2O7 and a molecular weight of 610.25 g/mol. Its IUPAC name is 3-[(4Z)-4-[[2,3-dibromo-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 3-[(4Z)-4-[[2,3-dibromo-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 22307043 |
| Molecular Formula | C24H22Br2N2O7 |
| Molecular Weight | 610.25 g/mol |
| Exact Mass | 607.98 |
| IUPAC Name | 3-[(4Z)-4-[[2,3-dibromo-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | CCOC(=O)COc1c(OCC)cc(/C=C2\C(=O)N(c3cccc(C(=O)O)c3)N=C2C)c(Br)c1Br |
| InChI | InChI=1S/C24H22Br2N2O7/c1-4-33-18-11-15(20(25)21(26)22(18)35-12-19(29)34-5-2)10-17-13(3)27-28(23(17)30)16-8-6-7-14(9-16)24(31)32/h6-11H,4-5,12H2,1-3H3,(H,31,32)/b17-10- |
| InChIKey | ASLYNZYNWBNKGF-YVLHZVERSA-N |
| XLogP | 5.06 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.25 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|