C17H8BrF5N2O — CID 124542667
(4E)-4-[(4-bromophenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 124542667) has the molecular formula C17H8BrF5N2O and a molecular weight of 431.16 g/mol. Its IUPAC name is (4E)-4-[(4-bromophenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[(4-bromophenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 124542667 |
| Molecular Formula | C17H8BrF5N2O |
| Molecular Weight | 431.16 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | (4E)-4-[(4-bromophenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H8BrF5N2O/c1-7-10(6-8-2-4-9(18)5-3-8)17(26)25(24-7)16-14(22)12(20)11(19)13(21)15(16)23/h2-6H,1H3/b10-6+ |
| InChIKey | LYRMNYGYRVYYSI-UXBLZVDNSA-N |
| XLogP | 4.95 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.16 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|