C20H15F5N2O — CID 126045197
(4E)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-4-[(4-propan-2-ylphenyl)methylidene]pyrazol-3-one (PubChem CID 126045197) has the molecular formula C20H15F5N2O and a molecular weight of 394.34 g/mol. Its IUPAC name is (4E)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-4-[(4-propan-2-ylphenyl)methylidene]pyrazol-3-one.
| Compound Name | (4E)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-4-[(4-propan-2-ylphenyl)methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 126045197 |
| Molecular Formula | C20H15F5N2O |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (4E)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-4-[(4-propan-2-ylphenyl)methylidene]pyrazol-3-one |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C/c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H15F5N2O/c1-9(2)12-6-4-11(5-7-12)8-13-10(3)26-27(20(13)28)19-17(24)15(22)14(21)16(23)18(19)25/h4-9H,1-3H3/b13-8+ |
| InChIKey | PHDQRKLLGLDGSB-MDWZMJQESA-N |
| XLogP | 5.31 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|