C21H17F5N2O3 — CID 126044161
(4E)-4-[(2,4-diethoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126044161) has the molecular formula C21H17F5N2O3 and a molecular weight of 440.37 g/mol. Its IUPAC name is (4E)-4-[(2,4-diethoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[(2,4-diethoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126044161 |
| Molecular Formula | C21H17F5N2O3 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (4E)-4-[(2,4-diethoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CCOc1ccc(/C=C2/C(=O)N(c3c(F)c(F)c(F)c(F)c3F)N=C2C)c(OCC)c1 |
| InChI | InChI=1S/C21H17F5N2O3/c1-4-30-12-7-6-11(14(9-12)31-5-2)8-13-10(3)27-28(21(13)29)20-18(25)16(23)15(22)17(24)19(20)26/h6-9H,4-5H2,1-3H3/b13-8+ |
| InChIKey | YSUKPKOHXJYEMX-MDWZMJQESA-N |
| XLogP | 4.99 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|