C22H17F5N2O3 — CID 137174096
(4E)-4-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 137174096) has the molecular formula C22H17F5N2O3 and a molecular weight of 452.38 g/mol. Its IUPAC name is (4E)-4-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 137174096 |
| Molecular Formula | C22H17F5N2O3 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (4E)-4-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | C=CCc1cc(/C=C2/C(=O)N(c3c(F)c(F)c(F)c(F)c3F)N=C2C)cc(OCC)c1O |
| InChI | InChI=1S/C22H17F5N2O3/c1-4-6-12-7-11(9-14(21(12)30)32-5-2)8-13-10(3)28-29(22(13)31)20-18(26)16(24)15(23)17(25)19(20)27/h4,7-9,30H,1,5-6H2,2-3H3/b13-8+ |
| InChIKey | OXFQQCKPSVSAEX-MDWZMJQESA-N |
| XLogP | 5.02 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|