C27H19F5N2O5 — CID 126053851
(4E)-4-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126053851) has the molecular formula C27H19F5N2O5 and a molecular weight of 546.45 g/mol. Its IUPAC name is (4E)-4-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126053851 |
| Molecular Formula | C27H19F5N2O5 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | (4E)-4-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CCOc1cc(/C=C2/C(=O)N(c3c(F)c(F)c(F)c(F)c3F)N=C2C)ccc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H19F5N2O5/c1-3-36-19-9-14(4-6-17(19)37-11-15-5-7-18-20(10-15)39-12-38-18)8-16-13(2)33-34(27(16)35)26-24(31)22(29)21(28)23(30)25(26)32/h4-10H,3,11-12H2,1-2H3/b16-8+ |
| InChIKey | MOCOHPBKTOMZSK-LZYBPNLTSA-N |
| XLogP | 5.89 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|