C30H30N2O5S — CID 6154151
(5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]-2-(4-methylphenyl)imino-3-propyl-1,3-thiazolidin-4-one (PubChem CID 6154151) has the molecular formula C30H30N2O5S and a molecular weight of 530.65 g/mol. Its IUPAC name is (5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]-2-(4-methylphenyl)imino-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]-2-(4-methylphenyl)imino-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6154151 |
| Molecular Formula | C30H30N2O5S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | (5E)-5-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylidene]-2-(4-methylphenyl)imino-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C\c2ccc(OCc3ccc4c(c3)OCO4)c(OCC)c2)S/C1=N\c1ccc(C)cc1 |
| InChI | InChI=1S/C30H30N2O5S/c1-4-14-32-29(33)28(38-30(32)31-23-10-6-20(3)7-11-23)17-21-8-12-24(26(15-21)34-5-2)35-18-22-9-13-25-27(16-22)37-19-36-25/h6-13,15-17H,4-5,14,18-19H2,1-3H3/b28-17+,31-30- |
| InChIKey | XTHFVNSUQAGEFO-BDIFOCAZSA-N |
| XLogP | 6.72 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|