C30H21F5N2O3 — CID 126043419
(4E)-4-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126043419) has the molecular formula C30H21F5N2O3 and a molecular weight of 552.50 g/mol. Its IUPAC name is (4E)-4-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126043419 |
| Molecular Formula | C30H21F5N2O3 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | (4E)-4-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CCOc1cc(/C=C2/C(=O)N(c3c(F)c(F)c(F)c(F)c3F)N=C2C)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C30H21F5N2O3/c1-3-39-23-14-17(11-12-22(23)40-15-19-9-6-8-18-7-4-5-10-20(18)19)13-21-16(2)36-37(30(21)38)29-27(34)25(32)24(31)26(33)28(29)35/h4-14H,3,15H2,1-2H3/b21-13+ |
| InChIKey | SBPRKOUMYKQXHW-FYJGNVAPSA-N |
| XLogP | 7.32 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|