C22H16F5IN2O5 — CID 126042793
ethyl 2-[4-iodo-2-methoxy-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 126042793) has the molecular formula C22H16F5IN2O5 and a molecular weight of 610.27 g/mol. Its IUPAC name is ethyl 2-[4-iodo-2-methoxy-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-iodo-2-methoxy-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126042793 |
| Molecular Formula | C22H16F5IN2O5 |
| Molecular Weight | 610.27 g/mol |
| Exact Mass | 610.00 |
| IUPAC Name | ethyl 2-[4-iodo-2-methoxy-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(/C=C2\C(=O)N(c3c(F)c(F)c(F)c(F)c3F)N=C2C)cc(I)cc1OC |
| InChI | InChI=1S/C22H16F5IN2O5/c1-4-34-14(31)8-35-21-10(5-11(28)7-13(21)33-3)6-12-9(2)29-30(22(12)32)20-18(26)16(24)15(23)17(25)19(20)27/h5-7H,4,8H2,1-3H3/b12-6- |
| InChIKey | RCNMXCSFMBLUOL-SDQBBNPISA-N |
| XLogP | 4.74 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|