C19H9F5I2N2O3 — CID 126037031
[2,4-diiodo-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenyl] acetate (PubChem CID 126037031) has the molecular formula C19H9F5I2N2O3 and a molecular weight of 662.09 g/mol. Its IUPAC name is [2,4-diiodo-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenyl] acetate.
| Compound Name | [2,4-diiodo-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 126037031 |
| Molecular Formula | C19H9F5I2N2O3 |
| Molecular Weight | 662.09 g/mol |
| Exact Mass | 661.86 |
| IUPAC Name | [2,4-diiodo-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(I)cc(I)cc1/C=C1\C(=O)N(c2c(F)c(F)c(F)c(F)c2F)N=C1C |
| InChI | InChI=1S/C19H9F5I2N2O3/c1-6-10(4-8-3-9(25)5-11(26)18(8)31-7(2)29)19(30)28(27-6)17-15(23)13(21)12(20)14(22)16(17)24/h3-5H,1-2H3/b10-4- |
| InChIKey | GLTYIALPVOQKKZ-WMZJFQQLSA-N |
| XLogP | 5.32 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.09 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|