C25H18F5N3O2 — CID 126046432
(4E)-4-[[1-(4-acetylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126046432) has the molecular formula C25H18F5N3O2 and a molecular weight of 487.43 g/mol. Its IUPAC name is (4E)-4-[[1-(4-acetylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[1-(4-acetylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126046432 |
| Molecular Formula | C25H18F5N3O2 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (4E)-4-[[1-(4-acetylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CC(=O)c1ccc(-n2c(C)cc(/C=C3/C(=O)N(c4c(F)c(F)c(F)c(F)c4F)N=C3C)c2C)cc1 |
| InChI | InChI=1S/C25H18F5N3O2/c1-11-9-16(13(3)32(11)17-7-5-15(6-8-17)14(4)34)10-18-12(2)31-33(25(18)35)24-22(29)20(27)19(26)21(28)23(24)30/h5-10H,1-4H3/b18-10+ |
| InChIKey | SBPWNWCLXMYDHF-VCHYOVAHSA-N |
| XLogP | 5.80 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|