C30H22F5N3O2 — CID 126054416
(4Z)-4-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126054416) has the molecular formula C30H22F5N3O2 and a molecular weight of 551.52 g/mol. Its IUPAC name is (4Z)-4-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4Z)-4-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126054416 |
| Molecular Formula | C30H22F5N3O2 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | (4Z)-4-[[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C\c1cc(C)n(-c2ccc(OCc3ccccc3)cc2)c1C |
| InChI | InChI=1S/C30H22F5N3O2/c1-16-13-20(18(3)37(16)21-9-11-22(12-10-21)40-15-19-7-5-4-6-8-19)14-23-17(2)36-38(30(23)39)29-27(34)25(32)24(31)26(33)28(29)35/h4-14H,15H2,1-3H3/b23-14- |
| InChIKey | VOHZTMDPPUVROL-UCQKPKSFSA-N |
| XLogP | 7.17 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|