About azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one
azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one (PubChem CID 70272256) has the molecular formula C15H15N3OS
and a molecular weight of 285.37 g/mol. Its IUPAC name is azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one.
Molecular Properties
| Compound Name | azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one |
| PubChem CID | 70272256 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1=Cc1cccs1.N |
| InChI | InChI=1S/C15H12N2OS.H3N/c1-11-14(10-13-8-5-9-19-13)15(18)17(16-11)12-6-3-2-4-7-12;/h2-10H,1H3;1H3 |
| InChIKey | ULFHGEHOMHJBEU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 67.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one?
The IUPAC name of azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one (CID 70272256) is azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one.
What is the SMILES notation for azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one?
The canonical SMILES for azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one is CC1=NN(c2ccccc2)C(=O)C1=Cc1cccs1.N.
What is the InChIKey of azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one?
The InChIKey is ULFHGEHOMHJBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2OS.H3N/c1-11-14(10-13-8-5-9-19-13)15(18)17(16-11)12-6-3-2-4-7-12;/h2-10H,1H3;1H3.
What are the key properties of azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one?
azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one has a molecular weight of 285.37 g/mol, XLogP of 3.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one is sourced from PubChem (CID 70272256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).