C24H22F3N3O — CID 126047236
(4E)-4-[(2,7-dimethyl-1-propylindol-3-yl)methylidene]-5-methyl-2-(2,4,5-trifluorophenyl)pyrazol-3-one (PubChem CID 126047236) has the molecular formula C24H22F3N3O and a molecular weight of 425.45 g/mol. Its IUPAC name is (4E)-4-[(2,7-dimethyl-1-propylindol-3-yl)methylidene]-5-methyl-2-(2,4,5-trifluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[(2,7-dimethyl-1-propylindol-3-yl)methylidene]-5-methyl-2-(2,4,5-trifluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126047236 |
| Molecular Formula | C24H22F3N3O |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (4E)-4-[(2,7-dimethyl-1-propylindol-3-yl)methylidene]-5-methyl-2-(2,4,5-trifluorophenyl)pyrazol-3-one |
| SMILES | CCCn1c(C)c(/C=C2/C(=O)N(c3cc(F)c(F)cc3F)N=C2C)c2cccc(C)c21 |
| InChI | InChI=1S/C24H22F3N3O/c1-5-9-29-15(4)18(16-8-6-7-13(2)23(16)29)10-17-14(3)28-30(24(17)31)22-12-20(26)19(25)11-21(22)27/h6-8,10-12H,5,9H2,1-4H3/b17-10+ |
| InChIKey | UPOWVSDCSAYZHN-LICLKQGHSA-N |
| XLogP | 5.89 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|