C24H20F3N3O — CID 126039770
(4E)-4-[(2,7-dimethyl-1-prop-2-enylindol-3-yl)methylidene]-2-phenyl-5-(trifluoromethyl)pyrazol-3-one (PubChem CID 126039770) has the molecular formula C24H20F3N3O and a molecular weight of 423.44 g/mol. Its IUPAC name is (4E)-4-[(2,7-dimethyl-1-prop-2-enylindol-3-yl)methylidene]-2-phenyl-5-(trifluoromethyl)pyrazol-3-one.
| Compound Name | (4E)-4-[(2,7-dimethyl-1-prop-2-enylindol-3-yl)methylidene]-2-phenyl-5-(trifluoromethyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126039770 |
| Molecular Formula | C24H20F3N3O |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (4E)-4-[(2,7-dimethyl-1-prop-2-enylindol-3-yl)methylidene]-2-phenyl-5-(trifluoromethyl)pyrazol-3-one |
| SMILES | C=CCn1c(C)c(/C=C2/C(=O)N(c3ccccc3)N=C2C(F)(F)F)c2cccc(C)c21 |
| InChI | InChI=1S/C24H20F3N3O/c1-4-13-29-16(3)19(18-12-8-9-15(2)21(18)29)14-20-22(24(25,26)27)28-30(23(20)31)17-10-6-5-7-11-17/h4-12,14H,1,13H2,2-3H3/b20-14+ |
| InChIKey | FBVHHHREOXQFMN-XSFVSMFZSA-N |
| XLogP | 5.79 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|