C22H18F5N5O3 — CID 126056677
(4E)-5-methyl-4-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126056677) has the molecular formula C22H18F5N5O3 and a molecular weight of 495.41 g/mol. Its IUPAC name is (4E)-5-methyl-4-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-5-methyl-4-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126056677 |
| Molecular Formula | C22H18F5N5O3 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (4E)-5-methyl-4-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methylidene]-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C/c1cc([N+](=O)[O-])ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C22H18F5N5O3/c1-11-14(22(33)31(28-11)21-19(26)17(24)16(23)18(25)20(21)27)10-12-9-13(32(34)35)3-4-15(12)30-7-5-29(2)6-8-30/h3-4,9-10H,5-8H2,1-2H3/b14-10+ |
| InChIKey | SZVCGXNVRQULOP-GXDHUFHOSA-N |
| XLogP | 3.85 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|