C23H27N3O — CID 171634211
(4E)-4-[[4-(diethylamino)-2-methylphenyl]methylidene]-5-methyl-2-(4-methylphenyl)pyrazol-3-one (PubChem CID 171634211) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is (4E)-4-[[4-(diethylamino)-2-methylphenyl]methylidene]-5-methyl-2-(4-methylphenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[4-(diethylamino)-2-methylphenyl]methylidene]-5-methyl-2-(4-methylphenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 171634211 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (4E)-4-[[4-(diethylamino)-2-methylphenyl]methylidene]-5-methyl-2-(4-methylphenyl)pyrazol-3-one |
| SMILES | CCN(CC)c1ccc(/C=C2/C(=O)N(c3ccc(C)cc3)N=C2C)c(C)c1 |
| InChI | InChI=1S/C23H27N3O/c1-6-25(7-2)21-13-10-19(17(4)14-21)15-22-18(5)24-26(23(22)27)20-11-8-16(3)9-12-20/h8-15H,6-7H2,1-5H3/b22-15+ |
| InChIKey | GFVAPUZCJRHXPE-PXLXIMEGSA-N |
| XLogP | 4.96 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|