C25H16ClF5N2O3 — CID 126043352
(4Z)-4-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126043352) has the molecular formula C25H16ClF5N2O3 and a molecular weight of 522.86 g/mol. Its IUPAC name is (4Z)-4-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4Z)-4-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126043352 |
| Molecular Formula | C25H16ClF5N2O3 |
| Molecular Weight | 522.86 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | (4Z)-4-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | COc1cccc(/C=C2\C(=O)N(c3c(F)c(F)c(F)c(F)c3F)N=C2C)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C25H16ClF5N2O3/c1-12-15(25(34)33(32-12)23-21(30)19(28)18(27)20(29)22(23)31)10-13-7-5-9-17(35-2)24(13)36-11-14-6-3-4-8-16(14)26/h3-10H,11H2,1-2H3/b15-10- |
| InChIKey | RXJNVHLFEJEJMH-GDNBJRDFSA-N |
| XLogP | 6.43 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.86 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|