C19H14ClN2O4- — CID 7165944
2-[4-chloro-2-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]phenoxy]acetate (PubChem CID 7165944) has the molecular formula C19H14ClN2O4- and a molecular weight of 369.78 g/mol. Its IUPAC name is 2-[4-chloro-2-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]phenoxy]acetate.
| Compound Name | 2-[4-chloro-2-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7165944 |
| Molecular Formula | C19H14ClN2O4- |
| Molecular Weight | 369.78 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-[4-chloro-2-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]phenoxy]acetate |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1=Cc1cc(Cl)ccc1OCC(=O)[O-] |
| InChI | InChI=1S/C19H15ClN2O4/c1-12-16(19(25)22(21-12)15-5-3-2-4-6-15)10-13-9-14(20)7-8-17(13)26-11-18(23)24/h2-10H,11H2,1H3,(H,23,24)/p-1 |
| InChIKey | OHXNKCCCGFXBBU-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.78 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|