C24H16BrClFN3O5 — CID 126016180
(5E)-5-[[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126016180) has the molecular formula C24H16BrClFN3O5 and a molecular weight of 560.76 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126016180 |
| Molecular Formula | C24H16BrClFN3O5 |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 558.99 |
| IUPAC Name | (5E)-5-[[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cc(Cl)c(OCc3ccc([N+](=O)[O-])cc3)c(Br)c2)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H16BrClFN3O5/c25-19-9-16(10-20(26)22(19)35-13-15-3-7-18(8-4-15)30(33)34)11-21-23(31)29(24(32)28-21)12-14-1-5-17(27)6-2-14/h1-11H,12-13H2,(H,28,32)/b21-11+ |
| InChIKey | GNNXJBJYONIQIF-SRZZPIQSSA-N |
| XLogP | 5.82 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|