C24H15Cl2FN2O4S2 — CID 4166698
5-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4166698) has the molecular formula C24H15Cl2FN2O4S2 and a molecular weight of 549.43 g/mol. Its IUPAC name is 5-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4166698 |
| Molecular Formula | C24H15Cl2FN2O4S2 |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 547.98 |
| IUPAC Name | 5-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cc(Cl)c(OCc3ccc([N+](=O)[O-])cc3)c(Cl)c2)SC(=S)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H15Cl2FN2O4S2/c25-19-9-16(10-20(26)22(19)33-13-15-3-7-18(8-4-15)29(31)32)11-21-23(30)28(24(34)35-21)12-14-1-5-17(27)6-2-14/h1-11H,12-13H2 |
| InChIKey | NYAQOIRMXJZIGX-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|