C20H15BrCl2N2O3 — CID 126134839
(5E)-5-[[3-bromo-5-chloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione (PubChem CID 126134839) has the molecular formula C20H15BrCl2N2O3 and a molecular weight of 482.16 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-5-chloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-5-chloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126134839 |
| Molecular Formula | C20H15BrCl2N2O3 |
| Molecular Weight | 482.16 g/mol |
| Exact Mass | 479.96 |
| IUPAC Name | (5E)-5-[[3-bromo-5-chloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)N/C(=C/c2cc(Cl)c(OCc3ccc(Cl)cc3)c(Br)c2)C1=O |
| InChI | InChI=1S/C20H15BrCl2N2O3/c1-2-7-25-19(26)17(24-20(25)27)10-13-8-15(21)18(16(23)9-13)28-11-12-3-5-14(22)6-4-12/h2-6,8-10H,1,7,11H2,(H,24,27)/b17-10+ |
| InChIKey | PHCXIDPAAMAPHZ-LICLKQGHSA-N |
| XLogP | 5.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.16 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|