C16H12Br2N2O3 — CID 126132915
(5E)-5-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione (PubChem CID 126132915) has the molecular formula C16H12Br2N2O3 and a molecular weight of 440.09 g/mol. Its IUPAC name is (5E)-5-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126132915 |
| Molecular Formula | C16H12Br2N2O3 |
| Molecular Weight | 440.09 g/mol |
| Exact Mass | 437.92 |
| IUPAC Name | (5E)-5-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C#CCOc1c(Br)cc(/C=C2/NC(=O)N(CC=C)C2=O)cc1Br |
| InChI | InChI=1S/C16H12Br2N2O3/c1-3-5-20-15(21)13(19-16(20)22)9-10-7-11(17)14(12(18)8-10)23-6-4-2/h2-3,7-9H,1,5-6H2,(H,19,22)/b13-9+ |
| InChIKey | LOBWEZFYSOXAIY-UKTHLTGXSA-N |
| XLogP | 3.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.09 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|