C29H17FN4O7S2 — CID 126111893
3-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide (PubChem CID 126111893) has the molecular formula C29H17FN4O7S2 and a molecular weight of 616.61 g/mol. Its IUPAC name is 3-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide.
| Compound Name | 3-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 126111893 |
| Molecular Formula | C29H17FN4O7S2 |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 616.05 |
| IUPAC Name | 3-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cccc(N2C(=O)/C(=C\c3cccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])c3)SC2=S)c1 |
| InChI | InChI=1S/C29H17FN4O7S2/c30-19-7-9-20(10-8-19)31-27(35)18-4-2-5-21(15-18)32-28(36)26(43-29(32)42)14-17-3-1-6-23(13-17)41-25-12-11-22(33(37)38)16-24(25)34(39)40/h1-16H,(H,31,35)/b26-14+ |
| InChIKey | LDIGYJINYASUQB-VULFUBBASA-N |
| XLogP | 7.09 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|