C28H23FN4O4S2 — CID 126107477
N-(4-fluorophenyl)-3-[(5E)-5-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126107477) has the molecular formula C28H23FN4O4S2 and a molecular weight of 562.65 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[(5E)-5-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | N-(4-fluorophenyl)-3-[(5E)-5-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126107477 |
| Molecular Formula | C28H23FN4O4S2 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | N-(4-fluorophenyl)-3-[(5E)-5-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cccc(N2C(=O)/C(=C\c3cc([N+](=O)[O-])ccc3N3CCCCC3)SC2=S)c1 |
| InChI | InChI=1S/C28H23FN4O4S2/c29-20-7-9-21(10-8-20)30-26(34)18-5-4-6-22(15-18)32-27(35)25(39-28(32)38)17-19-16-23(33(36)37)11-12-24(19)31-13-2-1-3-14-31/h4-12,15-17H,1-3,13-14H2,(H,30,34)/b25-17+ |
| InChIKey | VUNSUPPHEDLXJC-KOEQRZSOSA-N |
| XLogP | 6.38 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|