C21H27N3O6 — CID 145432901
5-[[4-(2-cyclohexylethoxy)-3-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione;ethane (PubChem CID 145432901) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is 5-[[4-(2-cyclohexylethoxy)-3-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione;ethane.
| Compound Name | 5-[[4-(2-cyclohexylethoxy)-3-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione;ethane |
|---|---|
| PubChem CID | 145432901 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 5-[[4-(2-cyclohexylethoxy)-3-nitrophenyl]methylidene]-1,3-diazinane-2,4,6-trione;ethane |
| SMILES | CC.O=C1NC(=O)C(=Cc2ccc(OCCC3CCCCC3)c([N+](=O)[O-])c2)C(=O)N1 |
| InChI | InChI=1S/C19H21N3O6.C2H6/c23-17-14(18(24)21-19(25)20-17)10-13-6-7-16(15(11-13)22(26)27)28-9-8-12-4-2-1-3-5-12;1-2/h6-7,10-12H,1-5,8-9H2,(H2,20,21,23,24,25);1-2H3 |
| InChIKey | QSTBBIKQSGOVIR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|