C20H25N3O6 — CID 145432880
5-[(3-nitro-4-nonoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 145432880) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is 5-[(3-nitro-4-nonoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(3-nitro-4-nonoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 145432880 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 5-[(3-nitro-4-nonoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCCCCCOc1ccc(C=C2C(=O)NC(=O)NC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H25N3O6/c1-2-3-4-5-6-7-8-11-29-17-10-9-14(13-16(17)23(27)28)12-15-18(24)21-20(26)22-19(15)25/h9-10,12-13H,2-8,11H2,1H3,(H2,21,22,24,25,26) |
| InChIKey | HELNDRAGDPWGNJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|