C25H36N2O5 — CID 145432975
5-[[4-(4-cyclohexylbutoxy)-3-methoxy-5-methylphenyl]methylidene]-1,3-diazinane-2,4,6-trione;ethane (PubChem CID 145432975) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is 5-[[4-(4-cyclohexylbutoxy)-3-methoxy-5-methylphenyl]methylidene]-1,3-diazinane-2,4,6-trione;ethane.
| Compound Name | 5-[[4-(4-cyclohexylbutoxy)-3-methoxy-5-methylphenyl]methylidene]-1,3-diazinane-2,4,6-trione;ethane |
|---|---|
| PubChem CID | 145432975 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 5-[[4-(4-cyclohexylbutoxy)-3-methoxy-5-methylphenyl]methylidene]-1,3-diazinane-2,4,6-trione;ethane |
| SMILES | CC.COc1cc(C=C2C(=O)NC(=O)NC2=O)cc(C)c1OCCCCC1CCCCC1 |
| InChI | InChI=1S/C23H30N2O5.C2H6/c1-15-12-17(13-18-21(26)24-23(28)25-22(18)27)14-19(29-2)20(15)30-11-7-6-10-16-8-4-3-5-9-16;1-2/h12-14,16H,3-11H2,1-2H3,(H2,24,25,26,27,28);1-2H3 |
| InChIKey | NCDAMKLDRXHWHW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|