C23H29NO3 — CID 157477885
(3E)-3-[[4-(4-cyclohexylbutoxy)phenyl]methylidene]-6-methylidenepiperidine-2,4-dione (PubChem CID 157477885) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (3E)-3-[[4-(4-cyclohexylbutoxy)phenyl]methylidene]-6-methylidenepiperidine-2,4-dione.
| Compound Name | (3E)-3-[[4-(4-cyclohexylbutoxy)phenyl]methylidene]-6-methylidenepiperidine-2,4-dione |
|---|---|
| PubChem CID | 157477885 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (3E)-3-[[4-(4-cyclohexylbutoxy)phenyl]methylidene]-6-methylidenepiperidine-2,4-dione |
| SMILES | C=C1CC(=O)/C(=C\c2ccc(OCCCCC3CCCCC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C23H29NO3/c1-17-15-22(25)21(23(26)24-17)16-19-10-12-20(13-11-19)27-14-6-5-9-18-7-3-2-4-8-18/h10-13,16,18H,1-9,14-15H2,(H,24,26)/b21-16+ |
| InChIKey | JWPRQINPSOFXCC-LTGZKZEYSA-N |
| XLogP | 4.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|