C19H15NO5 — CID 47046225
3-[4-[(Z)-(1,3-dioxoisoquinolin-4-ylidene)methyl]phenoxy]propanoic acid (PubChem CID 47046225) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is 3-[4-[(Z)-(1,3-dioxoisoquinolin-4-ylidene)methyl]phenoxy]propanoic acid.
| Compound Name | 3-[4-[(Z)-(1,3-dioxoisoquinolin-4-ylidene)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 47046225 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-[4-[(Z)-(1,3-dioxoisoquinolin-4-ylidene)methyl]phenoxy]propanoic acid |
| SMILES | O=C(O)CCOc1ccc(/C=C2\C(=O)NC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H15NO5/c21-17(22)9-10-25-13-7-5-12(6-8-13)11-16-14-3-1-2-4-15(14)18(23)20-19(16)24/h1-8,11H,9-10H2,(H,21,22)(H,20,23,24)/b16-11- |
| InChIKey | CKHIHYCDPRRCEB-WJDWOHSUSA-N |
| XLogP | 2.35 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|